ChemNet > CAS > 1070-62-8 Ethyl hydrogen glutarate
1070-62-8 Ethyl hydrogen glutarate
| Naam product |
Ethyl hydrogen glutarate |
| Engelse naam |
Ethyl hydrogen glutarate; Glutaric acid monoethyl ester~Monoethyl glutarate~Pentanedioic acid monoethyl ester; 5-ethoxy-5-oxopentanoic acid; monoethyl pentanedioate; 5-ethoxy-5-keto-valeric acid |
| MF |
C7H12O4 |
| Molecuulgewicht |
160.1678 |
| InChI |
InChI=1/C7H12O4/c1-2-11-7(10)5-3-4-6(8)9/h2-5H2,1H3,(H,8,9) |
| CAS-nummer |
1070-62-8 |
| EINECS |
213-977-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.126g/cm3 |
| Kookpunt |
280°C at 760 mmHg |
| Brekingsindex |
1.444 |
| Vlampunt |
112.5°C |
| Dampdruk |
0.00103mmHg at 25°C |
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|