ChemNet > CAS > 1070-62-8 Ethyl hydrogen glutarate
1070-62-8 Ethyl hydrogen glutarate
| product Name |
Ethyl hydrogen glutarate |
| CAS No |
1070-62-8 |
| Synonyms |
Glutaric acid monoethyl ester~Monoethyl glutarate~Pentanedioic acid monoethyl ester; 5-ethoxy-5-oxopentanoic acid; monoethyl pentanedioate; 5-ethoxy-5-keto-valeric acid |
| Molecular Formula |
C7H12O4 |
| Molecular Weight |
160.1678 |
| InChI |
InChI=1/C7H12O4/c1-2-11-7(10)5-3-4-6(8)9/h2-5H2,1H3,(H,8,9) |
| EINECS |
213-977-5 |
| Molecular Structure |
|
| Density |
1.126g/cm3 |
| Boiling point |
280°C at 760 mmHg |
| Refractive index |
1.444 |
| Flash point |
112.5°C |
| Vapour Pressur |
0.00103mmHg at 25°C |
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Specifications |
99% min |
| Contact |
Mr. Alexander Wang |
| Telephone |
+86-22-83739603 |
| Email |
sales@yuansu-reagent.com |
| Address |
No. 268, Yuliang Street, Dagang Street, Binhai New Area, Tianjin, China |