103-94-6 4-Nitrophenyloxamic acid
| ürün Ad? |
4-Nitrophenyloxamic acid |
| ingilizce ad? |
4-Nitrophenyloxamic acid; 4-Nitrooxanilic acid; [(4-nitrophenyl)amino](oxo)acetic acid |
| Moleküler Formülü |
C8H6N2O5 |
| Molekül A??rl??? |
210.1436 |
| InChI |
InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13) |
| CAS kay?t numaras? |
103-94-6 |
| EINECS |
203-160-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.629g/cm3 |
| K?r?lma indisi |
1.678 |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|