103-94-6 4-Nitrophenyloxamic acid
| Nome do produto |
4-Nitrophenyloxamic acid |
| Nome em inglês |
4-Nitrophenyloxamic acid; 4-Nitrooxanilic acid; [(4-nitrophenyl)amino](oxo)acetic acid |
| Fórmula molecular |
C8H6N2O5 |
| Peso Molecular |
210.1436 |
| InChI |
InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13) |
| CAS Registry Number |
103-94-6 |
| EINECS |
203-160-1 |
| Estrutura Molecular |
|
| Densidade |
1.629g/cm3 |
| índice de refra??o |
1.678 |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|