103-94-6 4-Nitrophenyloxamic acid
| produktnavn |
4-Nitrophenyloxamic acid |
| Engelsk navn |
4-Nitrophenyloxamic acid; 4-Nitrooxanilic acid; [(4-nitrophenyl)amino](oxo)acetic acid |
| Molekyl?r Formel |
C8H6N2O5 |
| Molekylvekt |
210.1436 |
| InChI |
InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13) |
| CAS-nummer |
103-94-6 |
| EINECS |
203-160-1 |
| Molecular Structure |
|
| Tetthet |
1.629g/cm3 |
| Brytningsindeks |
1.678 |
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|