10079-53-5;5344-78-5 4-bromo-3-nitroanisole
| ürün Ad? |
4-bromo-3-nitroanisole |
| ingilizce ad? |
4-bromo-3-nitroanisole; 4-BROMO-3-NITROTHIOANISOLE; TIMTEC-BB SBB009974; 1-bromo-4-methoxy-2-nitrobenzene |
| Moleküler Formülü |
C7H6BrNO3 |
| Molekül A??rl??? |
232.0314 |
| InChI |
InChI=1/C7H6BrNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| CAS kay?t numaras? |
10079-53-5;5344-78-5 |
| EINECS |
226-290-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.64g/cm3 |
| Ergime noktas? |
32-34℃ |
| Kaynama noktas? |
291°C at 760 mmHg |
| K?r?lma indisi |
1.581 |
| Alevlenme noktas? |
123°C |
| Buhar bas?nc? |
0.00349mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|