10079-53-5 4-bromo-3-nitroanisole
| product Name |
4-bromo-3-nitroanisole |
| CAS No |
10079-53-5;5344-78-5 |
| Synonyms |
4-BROMO-3-NITROTHIOANISOLE; TIMTEC-BB SBB009974; 1-bromo-4-methoxy-2-nitrobenzene |
| Molecular Formula |
C7H6BrNO3 |
| Molecular Weight |
232.0314 |
| InChI |
InChI=1/C7H6BrNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| EINECS |
226-290-0 |
| Molecular Structure |
|
| Density |
1.64g/cm3 |
| Melting point |
32-34℃ |
| Boiling point |
291°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
123°C |
| Vapour Pressur |
0.00349mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Contact |
Mr Chen Wei-dong |
| Telephone |
+86-21-64251386 |
| Email |
wdchen@shwychem.com |
| Address |
HQ in Shanghai: 4st Floor S&T Industry Building, 130 Meilong Road, Shanghai200237,China |
| Contact |
Frank Zhang |
| Telephone |
+86-571-85586753;+86-13336034509 |
| Email |
sales@fluoropharm.com |
| Address |
No.88 Jiangling RD,Xixing Street,Binjiang District,Hangzhou,Zhejiang,310051,China |
| Telephone |
+86-21-54450828,+86-13501997194 |
| Email |
coco.yang@fwdchem.com |
| Address |
Room 802,Lotus Tower ,159 Tianzhou Road, Xuhui District,Shanghai 200233 ,P.R.China |