10079-53-5;5344-78-5 4-bromo-3-nitroanisole
| Nome do produto |
4-bromo-3-nitroanisole |
| Nome em inglês |
4-bromo-3-nitroanisole; 4-BROMO-3-NITROTHIOANISOLE; TIMTEC-BB SBB009974; 1-bromo-4-methoxy-2-nitrobenzene |
| Fórmula molecular |
C7H6BrNO3 |
| Peso Molecular |
232.0314 |
| InChI |
InChI=1/C7H6BrNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| CAS Registry Number |
10079-53-5;5344-78-5 |
| EINECS |
226-290-0 |
| Estrutura Molecular |
|
| Densidade |
1.64g/cm3 |
| Ponto de fus?o |
32-34℃ |
| Ponto de ebuli??o |
291°C at 760 mmHg |
| índice de refra??o |
1.581 |
| O ponto de inflama??o |
123°C |
| Press?o de vapor |
0.00349mmHg at 25°C |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|