589-55-9 4-Heptanol
| ??? ?????? |
4-Heptanol |
| ????? ??????????? |
4-Heptanol; Dipropylcarbinol; heptan-4-ol |
| ?????? ???????? |
C7H16O |
| ????? ??????? ??????? |
116.2013 |
| InChI |
InChI=1/C7H16O/c1-3-5-7(8)6-4-2/h7-8H,3-6H2,1-2H3 |
| ?????????? ???????? ??????? |
589-55-9 |
| ???????? ????????? ??? |
209-651-7 |
| ???? ?????? |
|
| ????? |
0.818g/cm3 |
| ???? ??????? |
161.3°C at 760 mmHg |
| ????? ???????? |
1.42 |
| ???? ?????? |
61.8°C |
| ??? ?????? |
0.792mmHg at 25°C |
| ?????? ??? ??????? ?????? |
Xi:Irritant;
|
| ??? ????????? |
R10:Flammable.;
R36:Irritating to eyes.;
|
| ???? ????? |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|