589-55-9 4-Heptanol
| ???? |
4-Heptanol |
| ?? ?? |
4-Heptanol; Dipropylcarbinol; heptan-4-ol |
| ??? |
C7H16O |
| ??? |
116.2013 |
| InChI |
InChI=1/C7H16O/c1-3-5-7(8)6-4-2/h7-8H,3-6H2,1-2H3 |
| cas?? |
589-55-9 |
| EC?? |
209-651-7 |
| ?? ?? |
|
| ?? |
0.818g/cm3 |
| ??? |
161.3°C at 760 mmHg |
| ?? ?? |
1.42 |
| ??? |
61.8°C |
| ??? |
0.792mmHg at 25°C |
| ??? ?? |
Xi:Irritant;
|
| ??? ?? |
R10:Flammable.;
R36:Irritating to eyes.;
|
| ?? ?? |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|