589-55-9 4-Heptanol
| Nama produk |
4-Heptanol |
| Nama bahasa Inggris |
4-Heptanol; Dipropylcarbinol; heptan-4-ol |
| MF |
C7H16O |
| Berat Molekul |
116.2013 |
| InChI |
InChI=1/C7H16O/c1-3-5-7(8)6-4-2/h7-8H,3-6H2,1-2H3 |
| CAS NO |
589-55-9 |
| EINECS |
209-651-7 |
| Struktur Molekul |
|
| Kepadatan |
0.818g/cm3 |
| Titik didih |
161.3°C at 760 mmHg |
| Indeks bias |
1.42 |
| Titik nyala |
61.8°C |
| Tekanan uap |
0.792mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R10:Flammable.;
R36:Irritating to eyes.;
|
| Keselamatan Deskripsi |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|