459-59-6 4-Fluoro-N-methylaniline
| ??? ?????? |
4-Fluoro-N-methylaniline |
| ????? ??????????? |
4-Fluoro-N-methylaniline; 4-Fluoro-N-toluidine |
| ?????? ???????? |
C7H8FN |
| ????? ??????? ??????? |
125.1435 |
| InChI |
InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
| ?????????? ???????? ??????? |
459-59-6 |
| ???????? ????????? ??? |
207-294-1 |
| ???? ?????? |
|
| ????? |
1.106g/cm3 |
| ???? ??????? |
181.4°C at 760 mmHg |
| ????? ???????? |
1.546 |
| ???? ?????? |
63.5°C |
| ??? ?????? |
0.853mmHg at 25°C |
| ?????? ??? ??????? ?????? |
Xi:Irritant;
|
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|