459-59-6 4-Fluoro-N-methylaniline
| Produkt-Name |
4-Fluoro-N-methylaniline |
| Englischer Name |
4-Fluoro-N-methylaniline; 4-Fluoro-N-toluidine |
| Molekulare Formel |
C7H8FN |
| Molecular Weight |
125.1435 |
| InChI |
InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
| CAS Registry Number |
459-59-6 |
| EINECS |
207-294-1 |
| Molecular Structure |
|
| Dichte |
1.106g/cm3 |
| Siedepunkt |
181.4°C at 760 mmHg |
| Brechungsindex |
1.546 |
| Flammpunkt |
63.5°C |
| Dampfdruck |
0.853mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|