459-59-6 4-Fluoro-N-methylaniline
| termék neve |
4-Fluoro-N-methylaniline |
| Angol név |
4-Fluoro-N-methylaniline; 4-Fluoro-N-toluidine |
| MF |
C7H8FN |
| Molekulat?meg |
125.1435 |
| InChI |
InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
| CAS-szám |
459-59-6 |
| EINECS |
207-294-1 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.106g/cm3 |
| Forráspont |
181.4°C at 760 mmHg |
| T?résmutató |
1.546 |
| Gyulladáspont |
63.5°C |
| G?znyomás |
0.853mmHg at 25°C |
| Veszély szimbólumok |
Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|