942-92-7 Hexanophenone
| Nome do produto |
Hexanophenone |
| Nome em inglês |
Hexanophenone; n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
| Fórmula molecular |
C12H16O |
| Peso Molecular |
176.2548 |
| InChI |
InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
| CAS Registry Number |
942-92-7 |
| EINECS |
213-394-6 |
| Estrutura Molecular |
|
| Densidade |
0.942g/cm3 |
| Ponto de fus?o |
25-26℃ |
| Ponto de ebuli??o |
265°C at 760 mmHg |
| índice de refra??o |
1.498 |
| O ponto de inflama??o |
105.5°C |
| Press?o de vapor |
0.0094mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|