942-92-7 Hexanophenone
| Nazwa produktu: |
Hexanophenone |
| Angielska nazwa |
Hexanophenone; n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
| MF |
C12H16O |
| Masie cz?steczkowej |
176.2548 |
| InChI |
InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
| Nr CAS |
942-92-7 |
| EINECS |
213-394-6 |
| Struktury molekularnej |
|
| G?sto?? |
0.942g/cm3 |
| Temperatura topnienia |
25-26℃ |
| Temperatura wrzenia |
265°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.498 |
| Temperatura zap?onu |
105.5°C |
| Ci?nienie pary |
0.0094mmHg at 25°C |
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|