942-92-7 Hexanophenone
| Ονομασ?α του προ??ντο? |
Hexanophenone |
| Αγγλικ? ?νομα |
Hexanophenone; n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
| MF |
C12H16O |
| Μοριακ? β?ρο? |
176.2548 |
| InChI |
InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
| CAS ΟΧΙ |
942-92-7 |
| EINECS |
213-394-6 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
0.942g/cm3 |
| Σημε?ο τ?ξη? |
25-26℃ |
| Σημε?ο βρασμο? |
265°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.498 |
| Σημε?ο αν?φλεξη? |
105.5°C |
| Π?εση ατμ?ν |
0.0094mmHg at 25°C |
| Περιγραφ? τη? ασφ?λεια? |
S24/25:Avoid contact with skin and eyes.;
|
|