764-33-0 2-Hexynoic acid
| Nome do produto |
2-Hexynoic acid |
| Nome em inglês |
2-Hexynoic acid;hex-2-ynoic acid |
| Fórmula molecular |
C6H8O2 |
| Peso Molecular |
112.1265 |
| InChI |
InChI=1/C6H8O2/c1-2-3-4-5-6(7)8/h2-3H2,1H3,(H,7,8) |
| CAS Registry Number |
764-33-0 |
| Estrutura Molecular |
|
| Densidade |
1.062g/cm3 |
| Ponto de ebuli??o |
225.5°C at 760 mmHg |
| índice de refra??o |
1.469 |
| O ponto de inflama??o |
104.4°C |
| Press?o de vapor |
0.0315mmHg at 25°C |
| Códigos de risco |
R34:Causes burns.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|