764-33-0 2-Hexynoic acid
| Ονομασ?α του προ??ντο? |
2-Hexynoic acid |
| Αγγλικ? ?νομα |
2-Hexynoic acid;hex-2-ynoic acid |
| MF |
C6H8O2 |
| Μοριακ? β?ρο? |
112.1265 |
| InChI |
InChI=1/C6H8O2/c1-2-3-4-5-6(7)8/h2-3H2,1H3,(H,7,8) |
| CAS ΟΧΙ |
764-33-0 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.062g/cm3 |
| Σημε?ο βρασμο? |
225.5°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.469 |
| Σημε?ο αν?φλεξη? |
104.4°C |
| Π?εση ατμ?ν |
0.0315mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R34:Causes burns.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|