764-33-0 2-Hexynoic acid
| název vyrobku |
2-Hexynoic acid |
| Anglicky název |
2-Hexynoic acid;hex-2-ynoic acid |
| Molekulární vzorec |
C6H8O2 |
| Molekulová hmotnost |
112.1265 |
| InChI |
InChI=1/C6H8O2/c1-2-3-4-5-6(7)8/h2-3H2,1H3,(H,7,8) |
| Registra?ní ?íslo CAS |
764-33-0 |
| Molekulární struktura |
|
| Hustota |
1.062g/cm3 |
| Bod varu |
225.5°C at 760 mmHg |
| Index lomu |
1.469 |
| Bod vzplanutí |
104.4°C |
| Tlak par |
0.0315mmHg at 25°C |
| Riziko Codes |
R34:Causes burns.;
|
| Bezpe?nostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|