541-50-4 Acetoacetic Acid
| Nome do produto |
Acetoacetic Acid |
| Nome em inglês |
Acetoacetic Acid; 3-Oxobutanoic acid |
| Fórmula molecular |
C4H6O3 |
| Peso Molecular |
102.0886 |
| InChI |
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
| CAS Registry Number |
541-50-4 |
| Estrutura Molecular |
|
| Densidade |
1.182g/cm3 |
| Ponto de ebuli??o |
237.7°C at 760 mmHg |
| índice de refra??o |
1.427 |
| O ponto de inflama??o |
111.8°C |
| Press?o de vapor |
0.015mmHg at 25°C |
| Códigos de risco |
R36/37:Irritating to eyes and respiratory system.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|