541-50-4 Acetoacetic Acid
| Produkt-Name |
Acetoacetic Acid |
| Englischer Name |
Acetoacetic Acid; 3-Oxobutanoic acid |
| Molekulare Formel |
C4H6O3 |
| Molecular Weight |
102.0886 |
| InChI |
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
| CAS Registry Number |
541-50-4 |
| Molecular Structure |
|
| Dichte |
1.182g/cm3 |
| Siedepunkt |
237.7°C at 760 mmHg |
| Brechungsindex |
1.427 |
| Flammpunkt |
111.8°C |
| Dampfdruck |
0.015mmHg at 25°C |
| Risk Codes |
R36/37:Irritating to eyes and respiratory system.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|