541-50-4 Acetoacetic Acid
| Nama produk |
Acetoacetic Acid |
| Nama bahasa Inggris |
Acetoacetic Acid; 3-Oxobutanoic acid |
| MF |
C4H6O3 |
| Berat Molekul |
102.0886 |
| InChI |
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
| CAS NO |
541-50-4 |
| Struktur Molekul |
|
| Kepadatan |
1.182g/cm3 |
| Titik didih |
237.7°C at 760 mmHg |
| Indeks bias |
1.427 |
| Titik nyala |
111.8°C |
| Tekanan uap |
0.015mmHg at 25°C |
| Kode Risiko |
R36/37:Irritating to eyes and respiratory system.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|