ChemNet > CAS > 4900-63-4 1-Methoxy-4-nitronaphthalene
4900-63-4 1-Methoxy-4-nitronaphthalene
| Nome do produto |
1-Methoxy-4-nitronaphthalene |
| Nome em inglês |
1-Methoxy-4-nitronaphthalene; methyl 4-nitronaphthyl ether |
| Fórmula molecular |
C11H9NO3 |
| Peso Molecular |
203.1941 |
| InChI |
InChI=1/C11H9NO3/c1-15-11-7-6-10(12(13)14)8-4-2-3-5-9(8)11/h2-7H,1H3 |
| CAS Registry Number |
4900-63-4 |
| EINECS |
225-528-0 |
| Estrutura Molecular |
|
| Densidade |
1.274g/cm3 |
| Ponto de fus?o |
83-85℃ |
| Ponto de ebuli??o |
367.2°C at 760 mmHg |
| índice de refra??o |
1.638 |
| O ponto de inflama??o |
178.3°C |
| Press?o de vapor |
2.93E-05mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|