ChemNet > CAS > 4900-63-4 1-Methoxy-4-nitronaphthalene
4900-63-4 1-Methoxy-4-nitronaphthalene
| Nazwa produktu: |
1-Methoxy-4-nitronaphthalene |
| Angielska nazwa |
1-Methoxy-4-nitronaphthalene; methyl 4-nitronaphthyl ether |
| MF |
C11H9NO3 |
| Masie cz?steczkowej |
203.1941 |
| InChI |
InChI=1/C11H9NO3/c1-15-11-7-6-10(12(13)14)8-4-2-3-5-9(8)11/h2-7H,1H3 |
| Nr CAS |
4900-63-4 |
| EINECS |
225-528-0 |
| Struktury molekularnej |
|
| G?sto?? |
1.274g/cm3 |
| Temperatura topnienia |
83-85℃ |
| Temperatura wrzenia |
367.2°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.638 |
| Temperatura zap?onu |
178.3°C |
| Ci?nienie pary |
2.93E-05mmHg at 25°C |
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|