ChemNet > CAS > 4900-63-4 1-Methoxy-4-nitronaphthalene
4900-63-4 1-Methoxy-4-nitronaphthalene
| Naam product |
1-Methoxy-4-nitronaphthalene |
| Engelse naam |
1-Methoxy-4-nitronaphthalene; methyl 4-nitronaphthyl ether |
| MF |
C11H9NO3 |
| Molecuulgewicht |
203.1941 |
| InChI |
InChI=1/C11H9NO3/c1-15-11-7-6-10(12(13)14)8-4-2-3-5-9(8)11/h2-7H,1H3 |
| CAS-nummer |
4900-63-4 |
| EINECS |
225-528-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.274g/cm3 |
| Smeltpunt |
83-85℃ |
| Kookpunt |
367.2°C at 760 mmHg |
| Brekingsindex |
1.638 |
| Vlampunt |
178.3°C |
| Dampdruk |
2.93E-05mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|