4132-48-3 4-Isopropylanisole
| Nome do produto |
4-Isopropylanisole |
| Nome em inglês |
4-Isopropylanisole; 4-Methoxycumene; 1-methoxy-4-(propan-2-yl)benzene; 2-[(4-methoxybenzyl)sulfanyl]-5-[(4-nitrobenzyl)sulfanyl]-1,3,4-thiadiazole |
| Fórmula molecular |
C17H15N3O3S3 |
| Peso Molecular |
405.5143 |
| InChI |
InChI=1/C17H15N3O3S3/c1-23-15-8-4-13(5-9-15)11-25-17-19-18-16(26-17)24-10-12-2-6-14(7-3-12)20(21)22/h2-9H,10-11H2,1H3 |
| CAS Registry Number |
4132-48-3 |
| EINECS |
223-952-0 |
| Estrutura Molecular |
|
| Densidade |
1.45g/cm3 |
| Ponto de ebuli??o |
614.5°C at 760 mmHg |
| índice de refra??o |
1.696 |
| O ponto de inflama??o |
325.4°C |
| Press?o de vapor |
2.25E-14mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|