4132-48-3 4-Isopropylanisole
| product Name |
4-Isopropylanisole |
| CAS No |
4132-48-3 |
| Synonyms |
4-Methoxycumene; 1-methoxy-4-(propan-2-yl)benzene; 2-[(4-methoxybenzyl)sulfanyl]-5-[(4-nitrobenzyl)sulfanyl]-1,3,4-thiadiazole |
| Molecular Formula |
C17H15N3O3S3 |
| Molecular Weight |
405.5143 |
| InChI |
InChI=1/C17H15N3O3S3/c1-23-15-8-4-13(5-9-15)11-25-17-19-18-16(26-17)24-10-12-2-6-14(7-3-12)20(21)22/h2-9H,10-11H2,1H3 |
| EINECS |
223-952-0 |
| Molecular Structure |
|
| Density |
1.45g/cm3 |
| Boiling point |
614.5°C at 760 mmHg |
| Refractive index |
1.696 |
| Flash point |
325.4°C |
| Vapour Pressur |
2.25E-14mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|