4132-48-3 4-Isopropylanisole
| Nom |
4-Isopropylanisole |
| Nom anglais |
4-Isopropylanisole; 4-Methoxycumene; 1-methoxy-4-(propan-2-yl)benzene; 2-[(4-methoxybenzyl)sulfanyl]-5-[(4-nitrobenzyl)sulfanyl]-1,3,4-thiadiazole |
| Formule moléculaire |
C17H15N3O3S3 |
| Poids Moléculaire |
405.5143 |
| InChI |
InChI=1/C17H15N3O3S3/c1-23-15-8-4-13(5-9-15)11-25-17-19-18-16(26-17)24-10-12-2-6-14(7-3-12)20(21)22/h2-9H,10-11H2,1H3 |
| Numéro de registre CAS |
4132-48-3 |
| EINECS |
223-952-0 |
| Structure moléculaire |
|
| Densité |
1.45g/cm3 |
| Point d'ébullition |
614.5°C at 760 mmHg |
| Indice de réfraction |
1.696 |
| Point d'éclair |
325.4°C |
| Pression de vapeur |
2.25E-14mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|