4079-52-1 2-Methoxyacetophenone
| Nome do produto |
2-Methoxyacetophenone |
| Nome em inglês |
2-Methoxyacetophenone; 2-Acetylanisole; alpha-Methoxyacetophenone; 2-methoxy-1-phenylethanone; 1-(2-methoxyphenyl)ethanone |
| Fórmula molecular |
C9H10O2 |
| Peso Molecular |
150.1745 |
| InChI |
InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| CAS Registry Number |
4079-52-1 |
| EINECS |
223-802-4 |
| Estrutura Molecular |
|
| Densidade |
1.035g/cm3 |
| Ponto de fus?o |
7-8℃ |
| Ponto de ebuli??o |
245°C at 760 mmHg |
| índice de refra??o |
1.504 |
| O ponto de inflama??o |
92.8°C |
| Press?o de vapor |
0.0294mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|