4079-52-1 2-Methoxyacetophenone
| product Name |
2-Methoxyacetophenone |
| CAS No |
4079-52-1 |
| Synonyms |
2-Acetylanisole; alpha-Methoxyacetophenone; 2-methoxy-1-phenylethanone; 1-(2-methoxyphenyl)ethanone |
| Molecular Formula |
C9H10O2 |
| Molecular Weight |
150.1745 |
| InChI |
InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| EINECS |
223-802-4 |
| Molecular Structure |
|
| Density |
1.035g/cm3 |
| Melting point |
7-8℃ |
| Boiling point |
245°C at 760 mmHg |
| Refractive index |
1.504 |
| Flash point |
92.8°C |
| Vapour Pressur |
0.0294mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|