4079-52-1 2-Methoxyacetophenone
| Produkt-Name |
2-Methoxyacetophenone |
| Englischer Name |
2-Methoxyacetophenone; 2-Acetylanisole; alpha-Methoxyacetophenone; 2-methoxy-1-phenylethanone; 1-(2-methoxyphenyl)ethanone |
| Molekulare Formel |
C9H10O2 |
| Molecular Weight |
150.1745 |
| InChI |
InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| CAS Registry Number |
4079-52-1 |
| EINECS |
223-802-4 |
| Molecular Structure |
|
| Dichte |
1.035g/cm3 |
| Schmelzpunkt |
7-8℃ |
| Siedepunkt |
245°C at 760 mmHg |
| Brechungsindex |
1.504 |
| Flammpunkt |
92.8°C |
| Dampfdruck |
0.0294mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|