3098-92-8 Cinnamicacid vinylester
| Nome do produto |
Cinnamicacid vinylester |
| Nome em inglês |
Cinnamicacid vinylester; Cinnamic acid vinyl ester; Vinyl cinnamate, (Cinnamic acid vinyl ester); Vinyl cinnamate; ethenyl 3-phenylprop-2-enoate; ethenyl (2E)-3-phenylprop-2-enoate |
| Fórmula molecular |
C11H10O2 |
| Peso Molecular |
174.1959 |
| InChI |
InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h2-9H,1H2/b9-8+ |
| CAS Registry Number |
3098-92-8 |
| Estrutura Molecular |
|
| Densidade |
1.075g/cm3 |
| Ponto de ebuli??o |
267°C at 760 mmHg |
| índice de refra??o |
1.566 |
| O ponto de inflama??o |
105.9°C |
| Press?o de vapor |
0.00836mmHg at 25°C |
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|