3098-92-8 Cinnamicacid vinylester
| produktnavn |
Cinnamicacid vinylester |
| Engelsk navn |
Cinnamicacid vinylester; Cinnamic acid vinyl ester; Vinyl cinnamate, (Cinnamic acid vinyl ester); Vinyl cinnamate; ethenyl 3-phenylprop-2-enoate; ethenyl (2E)-3-phenylprop-2-enoate |
| Molekyl?r Formel |
C11H10O2 |
| Molekylvekt |
174.1959 |
| InChI |
InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h2-9H,1H2/b9-8+ |
| CAS-nummer |
3098-92-8 |
| Molecular Structure |
|
| Tetthet |
1.075g/cm3 |
| Kokepunkt |
267°C at 760 mmHg |
| Brytningsindeks |
1.566 |
| Flammepunktet |
105.9°C |
| Damptrykk |
0.00836mmHg at 25°C |
| Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|