3098-92-8 Cinnamicacid vinylester
| Ονομασ?α του προ??ντο? |
Cinnamicacid vinylester |
| Αγγλικ? ?νομα |
Cinnamicacid vinylester; Cinnamic acid vinyl ester; Vinyl cinnamate, (Cinnamic acid vinyl ester); Vinyl cinnamate; ethenyl 3-phenylprop-2-enoate; ethenyl (2E)-3-phenylprop-2-enoate |
| MF |
C11H10O2 |
| Μοριακ? β?ρο? |
174.1959 |
| InChI |
InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h2-9H,1H2/b9-8+ |
| CAS ΟΧΙ |
3098-92-8 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.075g/cm3 |
| Σημε?ο βρασμο? |
267°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.566 |
| Σημε?ο αν?φλεξη? |
105.9°C |
| Π?εση ατμ?ν |
0.00836mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|