1142-15-0 4-Methoxystilbene
| Nome do produto |
4-Methoxystilbene |
| Nome em inglês |
4-Methoxystilbene;p-Methoxystilbene; 1-methoxy-4-(2-phenylethenyl)benzene; 1-methoxy-4-[(E)-2-phenylethenyl]benzene |
| Fórmula molecular |
C15H14O |
| Peso Molecular |
210.2711 |
| InChI |
InChI=1/C15H14O/c1-16-15-11-9-14(10-12-15)8-7-13-5-3-2-4-6-13/h2-12H,1H3/b8-7+ |
| CAS Registry Number |
1142-15-0 |
| EINECS |
214-530-7 |
| Estrutura Molecular |
|
| Densidade |
1.069g/cm3 |
| Ponto de fus?o |
135-138℃ |
| Ponto de ebuli??o |
341.5°C at 760 mmHg |
| índice de refra??o |
1.634 |
| O ponto de inflama??o |
135.4°C |
| Press?o de vapor |
0.000159mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|