1142-15-0 4-Methoxystilbene
| product Name |
4-Methoxystilbene |
| CAS No |
1142-15-0 |
| Synonyms |
p-Methoxystilbene; 1-methoxy-4-(2-phenylethenyl)benzene; 1-methoxy-4-[(E)-2-phenylethenyl]benzene |
| Molecular Formula |
C15H14O |
| Molecular Weight |
210.2711 |
| InChI |
InChI=1/C15H14O/c1-16-15-11-9-14(10-12-15)8-7-13-5-3-2-4-6-13/h2-12H,1H3/b8-7+ |
| EINECS |
214-530-7 |
| Molecular Structure |
|
| Density |
1.069g/cm3 |
| Melting point |
135-138℃ |
| Boiling point |
341.5°C at 760 mmHg |
| Refractive index |
1.634 |
| Flash point |
135.4°C |
| Vapour Pressur |
0.000159mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|