1142-15-0 4-Methoxystilbene
| Nome del prodotto |
4-Methoxystilbene |
| Nome inglese |
4-Methoxystilbene;p-Methoxystilbene; 1-methoxy-4-(2-phenylethenyl)benzene; 1-methoxy-4-[(E)-2-phenylethenyl]benzene |
| Formula molecolare |
C15H14O |
| Peso Molecolare |
210.2711 |
| InChI |
InChI=1/C15H14O/c1-16-15-11-9-14(10-12-15)8-7-13-5-3-2-4-6-13/h2-12H,1H3/b8-7+ |
| Numero CAS |
1142-15-0 |
| EINECS |
214-530-7 |
| Struttura molecolare |
|
| Densità |
1.069g/cm3 |
| Punto di fusione |
135-138℃ |
| Punto di ebollizione |
341.5°C at 760 mmHg |
| Indice di rifrazione |
1.634 |
| Punto d'infiammabilità |
135.4°C |
| Pressione di vapore |
0.000159mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|