1004-66-6 2,6-Dimethylanisole
| Nome do produto |
2,6-Dimethylanisole |
| Nome em inglês |
2,6-Dimethylanisole; 1,3-Dimethyl-2-methoxybenzene; 2,6-Dimethylanisone; 2-Methoxy-m-xylene; 2-methoxy-1,3-dimethyl-benzene |
| Fórmula molecular |
C9H12O |
| Peso Molecular |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-5-4-6-8(2)9(7)10-3/h4-6H,1-3H3 |
| CAS Registry Number |
1004-66-6 |
| EINECS |
213-723-3 |
| Estrutura Molecular |
|
| Densidade |
0.932g/cm3 |
| Ponto de ebuli??o |
181°C at 760 mmHg |
| índice de refra??o |
1.495 |
| O ponto de inflama??o |
67.2°C |
| Press?o de vapor |
1.18mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|