1004-66-6 2,6-Dimethylanisole
| Nom |
2,6-Dimethylanisole |
| Nom anglais |
2,6-Dimethylanisole; 1,3-Dimethyl-2-methoxybenzene; 2,6-Dimethylanisone; 2-Methoxy-m-xylene; 2-methoxy-1,3-dimethyl-benzene |
| Formule moléculaire |
C9H12O |
| Poids Moléculaire |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-5-4-6-8(2)9(7)10-3/h4-6H,1-3H3 |
| Numéro de registre CAS |
1004-66-6 |
| EINECS |
213-723-3 |
| Structure moléculaire |
|
| Densité |
0.932g/cm3 |
| Point d'ébullition |
181°C at 760 mmHg |
| Indice de réfraction |
1.495 |
| Point d'éclair |
67.2°C |
| Pression de vapeur |
1.18mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|