1004-66-6 2,6-Dimethylanisole
| product Name |
2,6-Dimethylanisole |
| CAS No |
1004-66-6 |
| Synonyms |
1,3-Dimethyl-2-methoxybenzene; 2,6-Dimethylanisone; 2-Methoxy-m-xylene; 2-methoxy-1,3-dimethyl-benzene |
| Molecular Formula |
C9H12O |
| Molecular Weight |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-5-4-6-8(2)9(7)10-3/h4-6H,1-3H3 |
| EINECS |
213-723-3 |
| Molecular Structure |
|
| Density |
0.932g/cm3 |
| Boiling point |
181°C at 760 mmHg |
| Refractive index |
1.495 |
| Flash point |
67.2°C |
| Vapour Pressur |
1.18mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|