830-03-5 4-Nitrophenyl acetate
| Nazwa produktu: |
4-Nitrophenyl acetate |
| Angielska nazwa |
4-Nitrophenyl acetate; Acetic acid 4-nitrophenyl ester; p-Nitrophenol acetate |
| MF |
C8H7NO4 |
| Masie cz?steczkowej |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
| Nr CAS |
830-03-5 |
| EINECS |
212-593-5 |
| Struktury molekularnej |
|
| G?sto?? |
1.304g/cm3 |
| Temperatura topnienia |
76-79℃ |
| Temperatura wrzenia |
296.8°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.548 |
| Temperatura zap?onu |
145.2°C |
| Ci?nienie pary |
0.0014mmHg at 25°C |
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|