830-03-5 4-Nitrophenyl acetate
| Nama produk |
4-Nitrophenyl acetate |
| Nama bahasa Inggris |
4-Nitrophenyl acetate; Acetic acid 4-nitrophenyl ester; p-Nitrophenol acetate |
| MF |
C8H7NO4 |
| Berat Molekul |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
| CAS NO |
830-03-5 |
| EINECS |
212-593-5 |
| Struktur Molekul |
|
| Kepadatan |
1.304g/cm3 |
| Titik lebur |
76-79℃ |
| Titik didih |
296.8°C at 760 mmHg |
| Indeks bias |
1.548 |
| Titik nyala |
145.2°C |
| Tekanan uap |
0.0014mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|