830-03-5 4-Nitrophenyl acetate
| produktnavn |
4-Nitrophenyl acetate |
| Engelsk navn |
4-Nitrophenyl acetate; Acetic acid 4-nitrophenyl ester; p-Nitrophenol acetate |
| Molekyl?r Formel |
C8H7NO4 |
| Molekylvekt |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
| CAS-nummer |
830-03-5 |
| EINECS |
212-593-5 |
| Molecular Structure |
|
| Tetthet |
1.304g/cm3 |
| Smeltepunkt |
76-79℃ |
| Kokepunkt |
296.8°C at 760 mmHg |
| Brytningsindeks |
1.548 |
| Flammepunktet |
145.2°C |
| Damptrykk |
0.0014mmHg at 25°C |
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|