35354-37-1 1-Bromo-5-methylhexane
| Nazwa produktu: |
1-Bromo-5-methylhexane |
| Angielska nazwa |
1-Bromo-5-methylhexane; |
| MF |
C7H15Br |
| Masie cz?steczkowej |
179.098 |
| InChI |
InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3 |
| Nr CAS |
35354-37-1 |
| Struktury molekularnej |
|
| G?sto?? |
1.136g/cm3 |
| Temperatura wrzenia |
168°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.447 |
| Temperatura zap?onu |
48.4°C |
| Ci?nienie pary |
2.18mmHg at 25°C |
| Kody ryzyka |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|