35354-37-1 1-Bromo-5-methylhexane
| product Name |
1-Bromo-5-methylhexane |
| CAS No |
35354-37-1 |
| Molecular Formula |
C7H15Br |
| Molecular Weight |
179.098 |
| InChI |
InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.136g/cm3 |
| Boiling point |
168°C at 760 mmHg |
| Refractive index |
1.447 |
| Flash point |
48.4°C |
| Vapour Pressur |
2.18mmHg at 25°C |
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Kong Lingzhi;Wang qiang |
| Telephone |
+86-25-84651981 |
| Email |
sales@nastchem.com |
| Address |
Building 15-D,Rongchuang Scientific Research Center,No.99 Lize Road,Jiangning,Nanjing,China |