35354-37-1 1-Bromo-5-methylhexane
| Nome del prodotto |
1-Bromo-5-methylhexane |
| Nome inglese |
1-Bromo-5-methylhexane; |
| Formula molecolare |
C7H15Br |
| Peso Molecolare |
179.098 |
| InChI |
InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3 |
| Numero CAS |
35354-37-1 |
| Struttura molecolare |
|
| Densità |
1.136g/cm3 |
| Punto di ebollizione |
168°C at 760 mmHg |
| Indice di rifrazione |
1.447 |
| Punto d'infiammabilità |
48.4°C |
| Pressione di vapore |
2.18mmHg at 25°C |
| Codici di Rischio |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|