ChemNet > CAS > 1006-39-9 2-bromo-4-fluoroacetophenone
1006-39-9 2-bromo-4-fluoroacetophenone
| Nazwa produktu: |
2-bromo-4-fluoroacetophenone |
| Angielska nazwa |
2-bromo-4-fluoroacetophenone; 2'-bromo-4'-fluoroacetophenone; 1-(2-bromo-4-fluorophenyl)ethanone |
| MF |
C8H6BrFO |
| Masie cz?steczkowej |
217.035 |
| InChI |
InChI=1/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
| Nr CAS |
1006-39-9 |
| EINECS |
222-263-2 |
| Struktury molekularnej |
|
| G?sto?? |
1.535g/cm3 |
| Temperatura wrzenia |
258.4°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.534 |
| Temperatura zap?onu |
110.1°C |
| Ci?nienie pary |
0.0138mmHg at 25°C |
| Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|