ChemNet > CAS > 1006-39-9 2-bromo-4-fluoroacetophenone
1006-39-9 2-bromo-4-fluoroacetophenone
| Naam product |
2-bromo-4-fluoroacetophenone |
| Engelse naam |
2-bromo-4-fluoroacetophenone; 2'-bromo-4'-fluoroacetophenone; 1-(2-bromo-4-fluorophenyl)ethanone |
| MF |
C8H6BrFO |
| Molecuulgewicht |
217.035 |
| InChI |
InChI=1/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
| CAS-nummer |
1006-39-9 |
| EINECS |
222-263-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.535g/cm3 |
| Kookpunt |
258.4°C at 760 mmHg |
| Brekingsindex |
1.534 |
| Vlampunt |
110.1°C |
| Dampdruk |
0.0138mmHg at 25°C |
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|