ChemNet > CAS > 1006-39-9 2-bromo-4-fluoroacetophenone
1006-39-9 2-bromo-4-fluoroacetophenone
| ???? |
2-bromo-4-fluoroacetophenone |
| ?? ?? |
2-bromo-4-fluoroacetophenone; 2'-bromo-4'-fluoroacetophenone; 1-(2-bromo-4-fluorophenyl)ethanone |
| ??? |
C8H6BrFO |
| ??? |
217.035 |
| InChI |
InChI=1/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
| cas?? |
1006-39-9 |
| EC?? |
222-263-2 |
| ?? ?? |
|
| ?? |
1.535g/cm3 |
| ??? |
258.4°C at 760 mmHg |
| ?? ?? |
1.534 |
| ??? |
110.1°C |
| ??? |
0.0138mmHg at 25°C |
| ??? ?? |
R36/38:Irritating to eyes and skin.;
|
| ?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|